| Name |
Chikusetsusaponin V Chikusetsusaponin 5 Ginsenoside Ro Polysciasaponin P3 |
| Formula |
C48H76O19 |
| Mw |
956.49808025 |
| CAS RN |
34367-04-9 |
| C_ID |
C00029947
, 
|
| InChIKey |
NFZYDZXHKFHPGA-ZJUVOWTANA-N |
| InChICode |
InChI=1S/C48H76O19/c1-43(2)14-16-48(42(61)67-40-35(58)31(54)29(52)24(20-50)63-40)17-15-46(6)21(22(48)18-43)8-9-26-45(5)12-11-27(44(3,4)25(45)10-13-47(26,46)7)64-41-37(33(56)32(55)36(65-41)38(59)60)66-39-34(57)30(53)28(51)23(19-49)62-39/h8,22-37,39-41,49-58H,9-20H2,1-7H3,(H,59,60)/t22-,23+,24+,25-,26+,27-,28+,29+,30-,31-,32-,33-,34+,35+,36-,37+,39-,40-,41+,45-,46+,47+,48-/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](OC6O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]6O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes bidentata  | Ref. |
| Plantae | Amaranthaceae | Achyranthes fauriei | Ref. |
| Plantae | Araliaceae | Panax ginseng C.A.Meyer  | Ref. |
| Plantae | Araliaceae | Panax japonicum | Ref. |
| Plantae | Araliaceae | Panax pseudoginseng subsp.himalaicus.var.angustifolius.  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Achyranthes bidentata | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|