| Name |
5,6-Dehydrosugiol 5-Dehydrosugiol |
| Formula |
C20H26O2 |
| Mw |
298.19328007 |
| CAS RN |
21764-42-1 |
| C_ID |
C00029552
, 
|
| InChIKey |
HUMGJQLBBAYPNM-GNLPSFAGNA-N |
| InChICode |
InChI=1S/C20H26O2/c1-12(2)13-9-14-15(10-16(13)21)20(5)8-6-7-19(3,4)18(20)11-17(14)22/h9-12,21H,6-8H2,1-5H3/t20-/m1/s1 |
| SMILES |
CC(C)c1cc2c(cc1O)[C@@]1(C)CCCC(C)(C)C1=CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus lanceolata | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica D.DON. | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
|
|
zoom in
| Organism | Cephalotaxus lanceolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|