| Name |
4,5-Di-O-caffeoylquinic acid 4,5-Di-O-trans-caffeoyl quinic acid |
| Formula |
C25H24O12 |
| Mw |
516.12677623 |
| CAS RN |
89886-30-6 |
| C_ID |
C00029520
, 
|
| InChIKey |
UFCLZKMFXSILNL-OSTSEAKANA-N |
| InChICode |
InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,35H,11-12H2,(H,33,34)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@H](O)C[C@](O)(C(=O)O)C[C@H]1OC(=O)/C=C/c1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Solidago canadensis | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Artemisia annua | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|