| Name |
2alpha,3alpha-Dihydroxyurs-12-en-28-oic acid 3-Epicorosolic acid Pygenic acid A |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
52213-27-1 |
| C_ID |
C00029491
, 
|
| InChIKey |
HFGSQOYIOKBQOW-NETSDLRXNA-N |
| InChICode |
InChI=1S/C30H48O4/c1-17-10-13-30(25(33)34)15-14-28(6)19(23(30)18(17)2)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h8,17-18,20-24,31-32H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20-,21+,22-,23+,24-,27+,28-,29-,30+/m1/s1 |
| SMILES |
C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Labiatae | Perilla frutescens (L.) Britton var.japonica Hara  | Ref. |
|
|
zoom in
| Organism | Centella asiatica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|