| Name |
(E)-Methyl 3-(4-hydroxyphenyl)acrylate (E)-Methyl-4-hydroxycinnamate |
| Formula |
C10H10O3 |
| Mw |
178.06299419 |
| CAS RN |
19367-38-5 |
| C_ID |
C00029338
, 
|
| InChIKey |
NITWSHWHQAQBAW-QPJJXVBHSA-N |
| InChICode |
InChI=1S/C10H10O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7,11H,1H3/b7-4+ |
| SMILES |
COC(=O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Rubiaceae | Palicourea coriacea | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|