| Name |
Vasnetine |
| Formula |
C19H17N3O3 |
| Mw |
335.12699143 |
| CAS RN |
158734-26-0 |
| C_ID |
C00029180
, 
|
| InChIKey |
XROLSYQINIGIQK-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H17N3O3/c1-25-19(24)13-7-3-5-9-15(13)20-16-10-11-22-17(16)21-14-8-4-2-6-12(14)18(22)23/h2-9,16,20H,10-11H2,1H3/t16-/m0/s1 |
| SMILES |
COC(=O)c1ccccc1NC1CCn2c1nc1ccccc1c2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Adhatoda vasica  | Ref. |
| Plantae | Acanthaceae | Adhotoda vasica | Ref. |
|
|
zoom in
| Organism | Adhatoda vasica | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|