| Name |
Tenellin |
| Formula |
C21H23NO5 |
| Mw |
369.15762285 |
| CAS RN |
53823-15-7 |
| C_ID |
C00029081
, 
|
| InChIKey |
YELFBSBOFKWHSL-QDPFKYGGNA-N |
| InChICode |
InChI=1S/C21H23NO5/c1-4-13(2)11-14(3)5-10-18(24)19-20(25)17(12-22(27)21(19)26)15-6-8-16(23)9-7-15/h5-13,23,25,27H,4H2,1-3H3/b10-5+,14-11+/t13-/m0/s1 |
| SMILES |
CCC(C)/C=C(C)/C=C/C(=O)c1c(O)c(-c2ccc(O)cc2)cn(O)c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Bombycidae | Bombyx mori  | Ref. |
| Fungi | Cordycipitaceae | Beauveria bassiana | Ref. |
|
|
zoom in
| Organism | Bombyx mori |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
