| Name |
Sanjoinine G2 |
| Formula |
C30H42N4O5 |
| Mw |
538.31552048 |
| CAS RN |
107494-21-3 |
| C_ID |
C00028962
, 
|
| InChIKey |
CZLGNKWWWPJGFM-YIQLZBEBNA-N |
| InChICode |
InChI=1S/C30H42N4O5/c1-7-20(4)25(28(31)36)32-30(38)26(27(19(2)3)39-23-15-13-22(18-35)14-16-23)33-29(37)24(34(5)6)17-21-11-9-8-10-12-21/h8-16,18-20,24-27H,7,17H2,1-6H3,(H2,31,36)(H,32,38)(H,33,37)/t20-,24-,25-,26-,27-/m0/s1 |
| SMILES |
CCC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)N(C)C)[C@@H](Oc1ccc(C=O)cc1)C(C)C)C(N)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus jujube var. inermis | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris var. spinosus | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.spinosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|