| Name |
Sanjoinine G1 (-)-Sanjoinine G1 |
| Formula |
C31H44N4O5 |
| Mw |
552.33117054 |
| CAS RN |
107462-36-2 |
| C_ID |
C00028961
, 
|
| InChIKey |
YCIPFWPWHIKQMW-HNMVIBKONA-N |
| InChICode |
InChI=1S/C31H44N4O5/c1-7-20(4)26-30(38)32-18-25(36)22-13-15-23(16-14-22)40-28(19(2)3)27(31(39)33-26)34-29(37)24(35(5)6)17-21-11-9-8-10-12-21/h8-16,19-20,24-28,36H,7,17-18H2,1-6H3,(H,32,38)(H,33,39)(H,34,37)/t20-,24+,25+,26+,27+,28+/m1/s1 |
| SMILES |
CC[C@@H](C)C1NC(=O)[C@@H](NC(=O)[C@H](Cc2ccccc2)N(C)C)[C@H](C(C)C)Oc2ccc(cc2)[C@@H](O)CNC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus jujube var. inermis | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris var. spinosus | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.spinosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|