| Name |
Sanjoinine F |
| Formula |
C31H42N4O5 |
| Mw |
550.31552048 |
| CAS RN |
107462-35-1 |
| C_ID |
C00028959
, 
|
| InChIKey |
HIRIVYQNKNKCOO-WUKNDPDINA-N |
| InChICode |
InChI=1S/C31H42N4O5/c1-19(2)27(36)25-30(38)32-17-16-21-12-14-23(15-13-21)40-28(20(3)4)26(31(39)33-25)34-29(37)24(35(5)6)18-22-10-8-7-9-11-22/h7-17,19-20,24-28,36H,18H2,1-6H3,(H,32,38)(H,33,39)(H,34,37)/b17-16+/t24-,25-,26+,27+,28-/m0/s1 |
| SMILES |
CC(C)C(O)C1NC(=O)C(NC(=O)C(Cc2ccccc2)N(C)C)C(C(C)C)Oc2ccc(cc2)/C=C/NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus jujube var. inermis | Ref. |
| Plantae | Rhamnaceae | Zizyphus lotus  | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris var. spinosus | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.spinosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|