| Name |
Sanjoinine D O-Methylsanjoinine G1 |
| Formula |
C32H46N4O5 |
| Mw |
566.34682061 |
| CAS RN |
107462-34-0 |
| C_ID |
C00028958
, 
|
| InChIKey |
FYTPTQFRMLVCGF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C32H46N4O5/c1-8-21(4)27-31(38)33-19-26(40-7)23-14-16-24(17-15-23)41-29(20(2)3)28(32(39)34-27)35-30(37)25(36(5)6)18-22-12-10-9-11-13-22/h9-17,20-21,25-29H,8,18-19H2,1-7H3,(H,33,38)(H,34,39)(H,35,37)/t21-,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
CCC(C)C1NC(=O)C(NC(=O)C(Cc2ccccc2)N(C)C)C(C(C)C)Oc2ccc(cc2)C(OC)CNC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus jujube var. inermis | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris var. spinosus | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.spinosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|