| Name |
Sanjoinenine |
| Formula |
C29H35N3O4 |
| Mw |
489.26275663 |
| CAS RN |
107446-80-0 |
| C_ID |
C00028957
, 
|
| InChIKey |
WVYPBVOSAZSUAV-MTUSAYGMNA-N |
| InChICode |
InChI=1S/C29H35N3O4/c1-5-20(4)25-28(34)30-18-17-22-11-14-23(15-12-22)36-27(19(2)3)26(29(35)32-25)31-24(33)16-13-21-9-7-6-8-10-21/h6-20,25-27H,5H2,1-4H3,(H,30,34)(H,31,33)(H,32,35)/b16-13+,18-17+/t20-,25+,26+,27+/m0/s1 |
| SMILES |
CCC(C)C1NC(=O)C(NC(=O)/C=C/c2ccccc2)C(C(C)C)Oc2ccc(cc2)/C=C/NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus jujube var. inermis | Ref. |
| Plantae | Rhamnaceae | Zizyphus lotus  | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris var. spinosus | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.spinosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|