| Name |
Cotarnine |
| Formula |
C12H15NO4 |
| Mw |
237.10010798 |
| CAS RN |
82-54-2 |
| C_ID |
C00028091
, 
|
| InChIKey |
PAPMYQLKLNRZIR-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C12H15NO4/c1-13-4-3-7-5-8-10(17-6-16-8)11(15-2)9(7)12(13)14/h5,12,14H,3-4,6H2,1-2H3/t12-/m1/s1 |
| SMILES |
COc1c2c(cc3c1C(O)N(C)CC3)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver cylindricum | Ref. |
| Plantae | Papaveraceae | Papaver pseudo-orientale | Ref. |
|
|
zoom in
| Organism | Papaver cylindricum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|