| Name |
Corysolidine Ledeborine Ledecorine |
| Formula |
C20H19NO6 |
| Mw |
369.12123735 |
| CAS RN |
56816-35-4 |
| C_ID |
C00028088
, 
|
| InChIKey |
NVOAXRBBRLDXSC-YLBUIOQXNA-N |
| InChICode |
InChI=1S/C20H19NO6/c1-21-6-5-10-7-15(25-2)13(22)8-12(10)20(21)18(23)11-3-4-14-17(27-9-26-14)16(11)19(20)24/h3-4,7-8,19,22,24H,5-6,9H2,1-2H3/t19-,20-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)[C@@]1(C(=O)c3ccc4c(c3[C@@H]1O)OCO4)N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ledebouriana | Ref. |
| Plantae | Fumariaceae | Corydalis majori | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
|
|
zoom in
| Organism | Corydalis ledebouriana | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|