| Name |
Hyperectine |
| Formula |
C24H21N3O6 |
| Mw |
447.14303543 |
| CAS RN |
94656-46-9 |
| C_ID |
C00027546
, 
|
| InChIKey |
SPJFMVFHRMKUFD-OUNGTCIYNA-N |
| InChICode |
InChI=1S/C24H21N3O6/c1-27-5-4-11-6-15-16(32-9-31-15)7-13(11)24(27)8-12-2-3-14-21(33-10-30-14)17(12)19(24)18-20(25)23(29)26-22(18)28/h2-3,6-7,19H,4-5,8-10H2,1H3,(H3,25,26,28,29)/t19-,24-/m0/s1 |
| SMILES |
CN1CCc2cc3c(cc2[C@]12Cc1ccc4c(c1[C@H]2C1=C(N)C(=O)NC1=O)OCO4)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Hypecoum erectum | Ref. |
| Plantae | Fumariaceae | Hypecoum leptocarpum  | Ref. |
|
|
zoom in
| Organism | Hypecoum erectum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|