| Name |
N-Methylhydrasteine N-Methyliriodendronine |
| Formula |
C22H25NO7 |
| Mw |
415.16310216 |
| CAS RN |
31971-15-0 |
| C_ID |
C00027427
, 
|
| InChIKey |
UZMCBNLWPFVFFI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H25NO7/c1-23(2)8-7-13-10-18-19(30-12-29-18)11-14(13)9-16(24)15-5-6-17(27-3)21(28-4)20(15)22(25)26/h5-6,10-11H,7-9,12H2,1-4H3,(H,25,26) |
| SMILES |
COc1ccc(C(=O)Cc2cc3c(cc2CCN(C)C)OCO3)c(C(=O)O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Menispermaceae | Stephania dinklagei | Ref. |
|
|
zoom in
| Organism | Fumaria densiflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|