| Name |
Drupacine |
| Formula |
C18H21NO5 |
| Mw |
331.14197279 |
| CAS RN |
49686-57-9 |
| C_ID |
C00027347
, 
|
| InChIKey |
KYTDBKDWDOVRLJ-LIUDCKLBNA-N |
| InChICode |
InChI=1S/C18H21NO5/c1-21-18-8-17-3-2-4-19(17)7-14(24-18)10-5-12-13(23-9-22-12)6-11(10)15(17)16(18)20/h5-6,14-16,20H,2-4,7-9H2,1H3/t14-,15+,16-,17-,18+/m0/s1 |
| SMILES |
CO[C@]12C[C@]34CCCN3C[C@H](O1)c1cc3c(cc1[C@@H]4[C@@H]2O)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp L-Pro |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus hainanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia | Ref. |
|
|
zoom in
| Organism | Cephalotaxus hainanensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|