| Name |
N-Methyltetrahydrocytisine |
| Formula |
C12H20N2O |
| Mw |
208.15756328 |
| CAS RN |
18161-95-0 |
| C_ID |
C00026344
, 
|
| InChIKey |
ONDDMIQCYQALKD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C12H20N2O/c1-13-6-9-5-10(8-13)11-3-2-4-12(15)14(11)7-9/h9-11H,2-8H2,1H3/t9-,10+,11+/m1/s1 |
| SMILES |
CN1CC2CC(C1)C1CCCC(=O)N1C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Ormosia hosiei | Ref. |
| Plantae | Fabaceae | Ormosia indurata | Ref. |
|
|
zoom in
| Organism | Ormosia hosiei | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|