| Name |
Lasiocarpine N-oxide Lasiocarpine oxide Lasiocarpine, 4-oxide |
| Formula |
C21H33NO8 |
| Mw |
427.22061704 |
| CAS RN |
127-30-0 |
| C_ID |
C00026210
, 
|
| InChIKey |
AABILZKQMVKFHP-DDNCWLMPNA-N |
| InChICode |
InChI=1S/C21H33NO8/c1-7-13(2)18(23)30-16-9-11-22(27)10-8-15(17(16)22)12-29-19(24)21(26,14(3)28-6)20(4,5)25/h7-8,14,16-17,25-26H,9-12H2,1-6H3/b13-7+/t14-,16-,17-,21+,22-/m1/s1 |
| SMILES |
C/C=C(C)C(=O)OC1CC[N+]2([O-])CC=C(COC(=O)C(O)(C(C)OC)C(C)(C)O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-His Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium bovei | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium europeum | Ref. |
| Plantae | Boraginaceae | Heliotropium olgae | Ref. |
|
|
zoom in
| Organism | Heliotropium bovei | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|