| Name |
Ilamine (+)-Ilamine |
| Formula |
C16H27NO5 |
| Mw |
313.18892298 |
| CAS RN |
287177-67-7 |
| C_ID |
C00026203
, 
|
| InChIKey |
AKQZEFRALAUBFS-QJNGTDTRNA-N |
| InChICode |
InChI=1S/C16H27NO5/c1-11(21-4)16(20,15(2,3)19)14(18)22-10-12-7-9-17-8-5-6-13(12)17/h7,11,13,19-20H,5-6,8-10H2,1-4H3/t11-,13+,16+/m1/s1 |
| SMILES |
CO[C@H](C)[C@](O)(C(=O)OCC1=CCN2CCC[C@@H]12)C(C)(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium crassifoium | Ref. |
| Plantae | Boraginaceae | Heliotropium crassifolium | Ref. |
|
|
zoom in
| Organism | Heliotropium crassifoium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|