| Name |
Heliovicine |
| Formula |
C15H27NO4 |
| Mw |
285.19400836 |
| CAS RN |
68473-85-8 |
| C_ID |
C00026202
, 
|
| InChIKey |
BWQSLRZZOVFVHJ-SFJKVIHPNA-N |
| InChICode |
InChI=1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11-,12-,13-,15+/m0/s1 |
| SMILES |
CC(C)[C@](O)(C(=O)OC[C@@H]1CCN2CCC[C@@H]12)[C@H](C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium floridum | Ref. |
| Plantae | Boraginaceae | Heliotropium spathulatum | Ref. |
|
|
zoom in
| Organism | Heliotropium curassavicum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|