| Name |
Thalidastine |
| Formula |
C19H16NO5 |
| Mw |
338.10284763 |
| CAS RN |
4839-14-9 |
| C_ID |
C00026152
, 
|
| InChIKey |
LQGRWSKECPQNES-XISACWJONA-O |
| InChICode |
InChI=1S/C19H15NO5/c1-23-19-13-7-20-8-16(22)12-6-18-17(24-9-25-18)5-11(12)14(20)4-10(13)2-3-15(19)21/h2-7,16,22H,8-9H2,1H3/p+1/t16-/m0/s1 |
| SMILES |
COc1c(O)ccc2cc3[n+](cc12)C[C@H](O)c1cc2c(cc1-3)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Nandina domestica  | Ref. |
| Plantae | Ranunculaceae | Thalictrum fendleri Engelm. | Ref. |
| Plantae | Ranunculaceae | Thalictrum foetidum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum foliolosum DC  | Ref. |
| Plantae | Ranunculaceae | Thalictrum minus var.hypoleucum | Ref. |
| Plantae | Ranunculaceae | Thalictrum rogosum | Ref. |
|
|
zoom in
| Organism | Nandina domestica | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|