| Name |
(-)-(alpha)-Stylopine methiodide cis-N-Methylstylopinium iodide |
| Formula |
C20H20NO4I |
| Mw |
465.04370113 |
| CAS RN |
90457-62-8 |
| C_ID |
C00026083
, 
|
| InChIKey |
GBUUKFRQPCPYPW-SYAPSAMCNA-N |
| InChICode |
InChI=1S/C20H20NO4/c1-21-5-4-13-7-18-19(24-10-23-18)8-14(13)16(21)6-12-2-3-17-20(15(12)9-21)25-11-22-17/h2-3,7-8,16H,4-6,9-11H2,1H3/q+1/t16-,21-/m0/s1 |
| SMILES |
C[N@@+]12CCc3cc4c(cc3[C@@H]1Cc1ccc3c(c1C2)OCO3)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Papaveraceae | Chelidonium majus L.  | Ref. |
|
|
zoom in
| Organism | Fumaria densiflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|