| Name |
Pericyclivine (+)-Pericyclivine Deformoakuammidine |
| Formula |
C20H22N2O2 |
| Mw |
322.16812796 |
| CAS RN |
975-77-9 |
| C_ID |
C00026009
, 
|
| InChIKey |
VXRAIAAMNNTQES-ZDWUZTDPNA-N |
| InChICode |
InChI=1S/C20H22N2O2/c1-3-11-10-22-16-9-14-12-6-4-5-7-15(12)21-19(14)17(22)8-13(11)18(16)20(23)24-2/h3-7,13,16-18,21H,8-10H2,1-2H3/b11-3-/t13-,16-,17+,18-/m1/s1 |
| SMILES |
C/C=C1/C[N@]2C3Cc4c([nH]c5ccccc45)[C@@H]2CC1C3C(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana coffeoides Boj. | Ref. |
| Plantae | Apocynaceae | Tabernaemontana johnstonii (Stapf) Pichon | Ref. |
| Plantae | Apocynaceae | Tabernaemontana pachysiphon Stapf.  | Ref. |
| Plantae | Apocynaceae | Vinca rosea L.  | Ref. |
| - | - | Gabunia odoratissima | Ref. |
|
|
zoom in
| Organism | Catharanthus roseus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|