| Name |
11beta-Hydroxyhomodeoxyharringtonine |
| Formula |
C29H39NO9 |
| Mw |
545.26248185 |
| CAS RN |
184226-37-7 |
| C_ID |
C00025589
, 
|
| InChIKey |
UGSCGWGSJMKYHV-QZBGCWSKNA-N |
| InChICode |
InChI=1S/C29H39NO9/c1-17(2)7-5-9-29(34,14-24(32)36-4)27(33)39-26-23(35-3)13-28-8-6-10-30(28)15-20(31)18-11-21-22(38-16-37-21)12-19(18)25(26)28/h11-13,17,20,25-26,31,34H,5-10,14-16H2,1-4H3/t20-,25?,26-,28-,29-/m1/s1 |
| SMILES |
COC(=O)C[C@](O)(CCCC(C)C)C(=O)O[C@@H]1C(OC)=C[C@]23CCCN2C[C@@H](O)c2cc4c(cc2[C@H]13)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp L-Pro |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus hainanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia var.drupacea | Ref. |
|
|
zoom in
| Organism | Cephalotaxus hainanensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|