| Name |
Drupangtonine |
| Formula |
C28H37NO9 |
| Mw |
531.24683179 |
| CAS RN |
181133-84-6 |
| C_ID |
C00025587
, 
|
| InChIKey |
QLBRURRHLJMBJL-CQWCURFWNA-N |
| InChICode |
InChI=1S/C28H37NO9/c1-16(2)6-8-27(32,12-22(30)33-3)25(31)37-24-23-18-11-20-19(35-15-36-20)10-17(18)21-13-29-9-5-7-26(23,29)14-28(24,34-4)38-21/h10-11,16,21,23-24,32H,5-9,12-15H2,1-4H3/t21-,23+,24-,26-,27+,28+/m0/s1 |
| SMILES |
COC(=O)C[C@](O)(CCC(C)C)C(=O)O[C@H]1[C@H]2c3cc4c(cc3[C@@H]3CN5CCC[C@]25C[C@@]1(OC)O3)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp L-Pro |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus hainanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia var.drupacea | Ref. |
|
|
zoom in
| Organism | Cephalotaxus hainanensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|