| Name |
Homoneoharringtonine |
| Formula |
C31H35NO8 |
| Mw |
549.2362671 |
| CAS RN |
142942-95-8 |
| C_ID |
C00025580
, 
|
| InChIKey |
MVPLNIOIJYAVJX-ZIQARRDVNA-N |
| InChICode |
InChI=1S/C31H35NO8/c1-36-25-17-30-11-6-13-32(30)14-10-21-15-23-24(39-19-38-23)16-22(21)27(30)28(25)40-29(34)31(35,18-26(33)37-2)12-9-20-7-4-3-5-8-20/h3-5,7-8,15-17,27-28,35H,6,9-14,18-19H2,1-2H3/t27-,28-,30-,31-/m1/s1 |
| SMILES |
COC(=O)C[C@](O)(CCc1ccccc1)C(=O)O[C@@H]1C(OC)=C[C@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus hainanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia var.drupacea | Ref. |
|
|
zoom in
| Organism | Cephalotaxus hainanensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|