| Name |
Neoharringtonine |
| Formula |
C30H33NO8 |
| Mw |
535.22061704 |
| CAS RN |
142748-51-4 |
| C_ID |
C00025578
, 
|
| InChIKey |
RPOSUQSMDAYSCJ-WTARTMCHNA-N |
| InChICode |
InChI=1S/C30H33NO8/c1-35-24-16-29-10-6-11-31(29)12-9-20-13-22-23(38-18-37-22)14-21(20)26(29)27(24)39-28(33)30(34,17-25(32)36-2)15-19-7-4-3-5-8-19/h3-5,7-8,13-14,16,26-27,34H,6,9-12,15,17-18H2,1-2H3/t26?,27?,29-,30-/m1/s1 |
| SMILES |
COC(=O)C[C@](O)(Cc1ccccc1)C(=O)O[C@@H]1C(OC)=C[C@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus fortunei | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus fortuneri | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia var.drupacea | Ref. |
|
|
zoom in
| Organism | Cephalotaxus fortunei | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., APS, 27, (1992), 173 |
|---|
|