| Name |
Lycoclavine |
| Formula |
C18H29NO3 |
| Mw |
307.2147438 |
| CAS RN |
6900-91-0 |
| C_ID |
C00025388
, 
|
| InChIKey |
ZSZTZZJEQFTDFX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H29NO3/c1-11-9-13-14-5-3-7-19-8-4-6-15(18(14,19)10-11)17(16(13)21)22-12(2)20/h11,13-17,21H,3-10H2,1-2H3/t11-,13-,14+,15-,16-,17-,18-/m1/s1 |
| SMILES |
CC(=O)OC1C(O)C2CC(C)CC34C2CCCN3CCCC14 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Huperzia serrata  | Ref. |
| Plantae | Lycopodiaceae | Lycopodium alpinum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium clavatum var.megastachyon Fern.et Bissel.  | Ref. |
| Plantae | Lycopodiaceae | Lycopodium gnidioides | Ref. |
| Plantae | Lycopodiaceae | Lycopodium paniculatum | Ref. |
|
|
zoom in
| Organism | Huperzia serrata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|