| Name |
Rescinnamidine 2',3'-Dihydrorescinnamine |
| Formula |
C35H44N2O9 |
| Mw |
636.30468102 |
| CAS RN |
110222-52-1 |
| C_ID |
C00025205
, 
|
| InChIKey |
PYYLUPQQQNZLDO-ZVZRWGEGNA-N |
| InChICode |
InChI=1S/C35H44N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h8-9,13-14,16,20,24,26,29,31,34,36H,7,10-12,15,17-18H2,1-6H3/t20-,24-,26+,29-,31+,34+/m1/s1 |
| SMILES |
COC(=O)[C@H]1[C@H]2C[C@H]3c4[nH]c5cc(OC)ccc5c4CCN3C[C@H]2C[C@@H](OC(=O)CCc2cc(OC)c(OC)c(OC)c2)[C@@H]1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Rauvolfia serpentina  | Ref. |
| Plantae | Apocynaceae | Rauwolfia serpentina | Ref. |
|
|
zoom in
| Organism | Rauvolfia serpentina | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|