| Name |
Angustoline (-)-Angustoline |
| Formula |
C20H17N3O2 |
| Mw |
331.13207681 |
| CAS RN |
40041-95-0 |
| C_ID |
C00025154
, 
|
| InChIKey |
NDHJXXLIRWAMEN-LDGXTIHJNA-N |
| InChICode |
InChI=1S/C20H17N3O2/c1-11(24)15-9-21-10-16-14(15)8-18-19-13(6-7-23(18)20(16)25)12-4-2-3-5-17(12)22-19/h2-5,8-11,22,24H,6-7H2,1H3/t11-/m1/s1 |
| SMILES |
C[C@@H](O)c1cncc2c(=O)n3c(cc12)-c1[nH]c2ccccc2c1CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Longaniaceae | Strychnos angustiflora Benth. | Ref. |
| Plantae | Rubiaceae | Mitragyna hirsuta Havil | Ref. |
| Plantae | Rubiaceae | Nauclea officinalis  | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla  | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|