| Name |
10-Methoxycinchonamine |
| Formula |
C20H26N2O2 |
| Mw |
326.19942809 |
| CAS RN |
83852-64-6 |
| C_ID |
C00025132
, 
|
| InChIKey |
LSCMBADHRZWQFC-DRHRYECJNA-N |
| InChICode |
InChI=1S/C20H26N2O2/c1-3-13-12-22-8-6-14(13)10-19(22)20-16(7-9-23)17-11-15(24-2)4-5-18(17)21-20/h3-5,11,13-14,19,21,23H,1,6-10,12H2,2H3/t13-,14-,19-/m0/s1 |
| SMILES |
C=C[C@H]1C[N@]2CC[C@H]1C[C@H]2c1[nH]c2ccc(OC)cc2c1CCO |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Cinchona pubescens  | Ref. |
| Plantae | Rubiaceae | Cinchona succirubra Pav.  | Ref. |
|
|
zoom in
| Organism | Cinchona pubescens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|