| Name |
Lepetine 11-acetyllepenine 11-O-Acetyllepenine |
| Formula |
C24H35NO4 |
| Mw |
401.25660861 |
| CAS RN |
111509-08-1 |
| C_ID |
C00024927
, 
|
| InChIKey |
WYDGCJLTZZIEHA-HOEXUFCXNA-N |
| InChICode |
InChI=1S/C24H35NO4/c1-5-25-11-22(4)8-7-17(27)24-16(22)10-15(20(24)25)23-9-6-14(12(2)21(23)28)18(19(23)24)29-13(3)26/h14-21,27-28H,2,5-11H2,1,3-4H3/t14-,15+,16-,17+,18+,19-,20-,21-,22+,23+,24-/m1/s1 |
| SMILES |
C=C1[C@H]2CC[C@]3([C@@H]1O)[C@H]1C[C@@H]4C5(C)CC[C@H](O)C4([C@@H]1N(CC)C5)[C@@H]3[C@H]2OC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum kirinense | Ref. |
| Plantae | Ranunculaceae | Aconitum leucostomum | Ref. |
| Plantae | Ranunculaceae | Aconitum pseudohuilense | Ref. |
| Plantae | Ranunculaceae | Aconitum pseudohuiliense | Ref. |
|
|
zoom in
| Organism | Aconitum kirinense | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Feng, et al., Zhongguo Yaoke Daxue Xuebao, 34, (2003), 17 |
|---|
|