| Name |
Corynoloxine |
| Formula |
C21H19NO5 |
| Mw |
365.12632273 |
| CAS RN |
31470-65-2 |
| C_ID |
C00024639
, 
|
| InChIKey |
MARJZNJEWWKEKF-GAPMRVOCNA-N |
| InChICode |
InChI=1S/C21H19NO5/c1-21-12-3-4-13-18(26-9-23-13)17(12)20-22(2)19(21)11-7-15-14(24-8-25-15)5-10(11)6-16(21)27-20/h3-5,7,16,19-20H,6,8-9H2,1-2H3/t16-,19+,20-,21-/m0/s1 |
| SMILES |
CN1[C@H]2O[C@H]3Cc4cc5c(cc4[C@@H]1[C@@]3(C)c1ccc3c(c12)OCO3)OCO5 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis conspersa | Ref. |
| Plantae | Fumariaceae | Corydalis incisa | Ref. |
|
|
zoom in
| Organism | Corydalis bungeana |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
