| Name |
Gerontoxanthone C |
| Formula |
C23H24O6 |
| Mw |
396.1572885 |
| CAS RN |
121825-54-5 |
| C_ID |
C00024195
, 
|
| InChIKey |
MPGIKBDCZHZTJM-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C23H24O6/c1-10(2)6-7-13-20-15(19(27)16-21(13)28-11(3)23(16,4)5)17(25)12-8-9-14(24)18(26)22(12)29-20/h6,8-9,11,24,26-27H,7H2,1-5H3/t11-/m0/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c(=O)c4ccc(O)c(O)c4oc13)C(C)(C)C(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia penangiana | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis (LOUR.) KUDO & MASAMUNE var.gerontogea (S.& Z.) KUDO & MASAMUNE  | Ref. |
|
|
zoom in
| Organism | Garcinia penangiana | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|