| Name |
Syringin-4-O-beta-glucoside |
| Formula |
C23H34O14 |
| Mw |
534.1948558 |
| CAS RN |
184177-52-4 |
| C_ID |
C00024143
, 
|
| InChIKey |
FDFFTANGEOQYRW-GVHSSRBLNA-N |
| InChICode |
InChI=1S/C23H34O14/c1-32-11-6-10(4-3-5-24)7-12(33-2)20(11)36-23-19(31)17(29)21(14(9-26)35-23)37-22-18(30)16(28)15(27)13(8-25)34-22/h3,5-7,13-19,21-31H,4,8-9H2,1-2H3/b5-3-/t13-,14-,15+,16+,17+,18-,19-,21+,22-,23-/m0/s1 |
| SMILES |
COc1cc(C/C=CO)cc(OC)c1O[C@@H]1OC(CO)[C@@H](O[C@@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Magnoliaceae | Magnolia sieboldii K.KOCH  | Ref. |
|
|
zoom in
| Organism | Foeniculum vulgare | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|