| Name |
Fasciculol A
2alpha,3beta,24(R),25-Tetrahydroxylanost-8-ene |
| Formula |
C30H52O4 |
| Mw |
476.38656015 |
| CAS RN |
64971-21-7 |
| C_ID |
C00023891
, 
|
| InChIKey |
ZJBUVOQLORAVHG-JIOPYLMNNA-N |
| InChICode |
InChI=1S/C30H52O4/c1-18(9-12-24(32)27(4,5)34)19-13-15-30(8)21-10-11-23-26(2,3)25(33)22(31)17-28(23,6)20(21)14-16-29(19,30)7/h18-19,22-25,31-34H,9-17H2,1-8H3/t18-,19-,22-,23+,24-,25+,28-,29-,30+/m1/s1 |
| SMILES |
C[C@H](CC[C@@H](O)C(C)(C)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]1CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| - | - | Neamatoloma fasciculare | Ref. |
|
|
zoom in
| Organism | Neamatoloma fasciculare |
|---|
| Reference | Ikeda,Agric.Biol.Chem,41,(1977),1539-1541
Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II
Academic Press,New York,NY,319 pp.(1983)
Weete,Structure and Function |
|---|
|
