| Name |
Pisolactone (22S)24-Methyllanost-8-en-22,28-epoxy-3beta-ol-28-one |
| Formula |
C31H50O3 |
| Mw |
470.37599546 |
| CAS RN |
87164-33-8 |
| C_ID |
C00023806
, 
|
| InChIKey |
TWOLTMVJWNRWJQ-ZRAOWVRZNA-N |
| InChICode |
InChI=1S/C31H50O3/c1-18(2)20-17-24(34-27(20)33)19(3)21-11-15-31(8)23-9-10-25-28(4,5)26(32)13-14-29(25,6)22(23)12-16-30(21,31)7/h18-21,24-26,32H,9-17H2,1-8H3/t19-,20+,21+,24-,25-,26-,29+,30+,31-/m0/s1 |
| SMILES |
CC(C)[C@H]1C[C@@H]([C@@H](C)[C@H]2CC[C@@]3(C)C4=C(CC[C@]23C)[C@@]2(C)CC[C@H](O)C(C)(C)[C@@H]2CC4)OC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Sclerodermataceae | Pisolithus tinctorius  | Ref. |
|
|
zoom in
| Organism | Pisolithus tinctorius | | Reference | Lobo,Tetrahedron Letters,24,(1983),2205-2208
Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II
Academic Press,New York,NY,319 pp.(1983) |
|---|
|