| Name |
Cholesta-7,24-dien-3beta-ol Zymosterol |
| Formula |
C27H44O |
| Mw |
384.33921603 |
| CAS RN |
128-33-6 |
| C_ID |
C00023749
, 
|
| InChIKey |
CGSJXLIKVBJVRY-AKRUHWLCNA-N |
| InChICode |
InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C[C@@H]1CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Saccharomycetaceae | Saccharomyces cerevisiae  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Saccharomyces cerevisiae | | Reference | Barton,J.Chem.Soc.,Perkin Trans,1,(1972),513-522
Heupel,Isolation and Primary Characterization of Sterols,In Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,(1989),1-27
Turner,Fungal Metabolites II
Academic |
|---|
|