| Name |
7-Dehydrocholesterol Provitamin D3,Cholesta-5,7-dien-3beta-ol |
| Formula |
C27H44O |
| Mw |
384.33921603 |
| CAS RN |
434-16-2 |
| C_ID |
C00023747
, 
|
| InChIKey |
UCTLRSWJYQTBFZ-LOPSNSAJNA-N |
| InChICode |
InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9-10,18-19,21,23-25,28H,6-8,11-17H2,1-5H3/t19-,21+,23-,24+,25+,26+,27-/m1/s1 |
| SMILES |
CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Hypocreaceae | Nectria galligena | Ref. |
| Fungi | Russulaceae | Lactarius sp. | Ref. |
| Fungi | Russulaceae | Russula aeruginosa | Ref. |
| Fungi | Russulaceae | Russula decolorans  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Nectria galligena | | Reference | B.Dehorter,Phytochem.,19,(1980),2311-2316
Heupel,Isolation and Primary Characterization of Sterols,In Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,(1989),1-27
Jayko,Canad.J.Microbiol.,8,(1962),361-371 |
|---|
|