| Name |
22-Dehydrocholesterol Cholesta-5,22-dien-3beta-ol cis-22-Dehydrocholesterol |
| Formula |
C27H44O |
| Mw |
384.33921603 |
| CAS RN |
26033-10-3 |
| C_ID |
C00023745
, 
|
| InChIKey |
UPGTYLFCVNHBTN-OGPIFZCONA-N |
| InChICode |
InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h6,8-9,18-19,21-25,28H,7,10-17H2,1-5H3/b8-6-/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| SMILES |
CC(C)C/C=C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| - | - | Hypnea japonica  | Ref. |
| - | - | Rhizophlyctis rosea | Ref. |
|
|
zoom in
| Organism | Physarum polycephalum | | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II
Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function of Sterols in Fungi,Advances in Lipid Rese |
|---|
|