| Name |
Demethoxyencecalin |
| Formula |
C13H14O2 |
| Mw |
202.09937969 |
| CAS RN |
19013-07-1 |
| C_ID |
C00023229
, 
|
| InChIKey |
ZAJTXVHECZCXLH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H14O2/c1-9(14)10-4-5-12-11(8-10)6-7-13(2,3)15-12/h4-8H,1-3H3 |
| SMILES |
CC(=O)c1ccc2c(c1)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Hemizonia congesta | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|