| Name |
Jhanol |
| Formula |
C20H34O2 |
| Mw |
306.25588033 |
| CAS RN |
62929-59-3 |
| C_ID |
C00022376
, 
|
| InChIKey |
MONXCRDSDZQGGT-SZAKBSEYNA-N |
| InChICode |
InChI=1S/C20H34O2/c1-6-18(3)12-8-16-19(4)11-7-10-17(2,14-21)15(19)9-13-20(16,5)22-18/h6,15-16,21H,1,7-14H2,2-5H3/t15-,16+,17-,18-,19-,20+/m0/s1 |
| SMILES |
C=C[C@@]1(C)CC[C@@H]2[C@@]3(C)CCC[C@@](C)(CO)[C@@H]3CC[C@@]2(C)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina jahnii | Ref. |
| Plantae | Asteraceae | Eupatorium jhanii | Ref. |
| Plantae | Asteraceae | Grindelia scorzonerifolia | Ref. |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
|
|
zoom in
| Organism | Ageratina jahnii | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|