| Name |
Jhanidiol |
| Formula |
C20H34O3 |
| Mw |
322.25079495 |
| CAS RN |
62871-02-7 |
| C_ID |
C00022342
, 
|
| InChIKey |
SSTWIVKWXKKFTH-WZHRTAKCNA-N |
| InChICode |
InChI=1S/C20H34O3/c1-6-18(3)11-7-15-19(4,23-18)12-8-14-17(2,13-21)10-9-16(22)20(14,15)5/h6,14-16,21-22H,1,7-13H2,2-5H3/t14-,15-,16+,17-,18-,19+,20-/m0/s1 |
| SMILES |
C=C[C@@]1(C)CC[C@@H]2[C@@]3(C)[C@H](O)CC[C@@](C)(CO)[C@@H]3CC[C@@]2(C)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina jahnii | Ref. |
| Plantae | Asteraceae | Eupatorium jhanii | Ref. |
|
|
zoom in
| Organism | Ageratina jahnii | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|