| Name |
Pyrovellerolactone |
| Formula |
C15H20O2 |
| Mw |
232.14632988 |
| CAS RN |
68582-98-9 |
| C_ID |
C00021553
, 
|
| InChIKey |
SKKVKZCMCUKCDI-WEMDXDIQNA-N |
| InChICode |
InChI=1S/C15H20O2/c1-9-4-12-11(8-17-14(12)16)5-10-6-15(2,3)7-13(9)10/h4-5,9-10,13H,6-8H2,1-3H3/t9-,10-,13+/m1/s1 |
| SMILES |
C[C@H]1C=C2C(=O)OCC2=C[C@H]2CC(C)(C)C[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Russulaceae | Lactarius pergamenus | Ref. |
| Fungi | Russulaceae | Lactarius vellereus  | Ref. |
|
|
zoom in
| Organism | Lactarius pergamenus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11
Magnusson,Acta Chem. Scand.,Ser. B 27,(1973),1573 |
|---|
|