| Name |
Pterosin S |
| Formula |
C14H18O4 |
| Mw |
250.12050906 |
| CAS RN |
56227-00-0 |
| C_ID |
C00021516
, 
|
| InChIKey |
VUTYSCZGARSHDC-UZVITXAGNA-N |
| InChICode |
InChI=1S/C14H18O4/c1-7-5-10-12(14(18)8(2)13(10)17)11(6-16)9(7)3-4-15/h5,8,13,15-17H,3-4,6H2,1-2H3/t8-,13-/m0/s1 |
| SMILES |
Cc1cc2c(c(CO)c1CCO)C(=O)[C@@H](C)[C@@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pteridaceae | Pteris cretica | Ref. |
| Plantae | Pteridaceae | Pteris cretica var.nervosa | Ref. |
| Plantae | Pteridaceae | Pteris kiuschiuensis | Ref. |
| Plantae | Pteridaceae | Pteris kiushinensis | Ref. |
| Plantae | Pteridaceae | Pteris multifida  | Ref. |
|
|
zoom in
| Organism | Pteris cretica | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Murakami, et al., J of Pharm Society(Japan), 105, (1985), 640 |
|---|
|