| Name |
Leucodelphinidin |
| Formula |
C15H14O8 |
| Mw |
322.06886743 |
| CAS RN |
491-52-1 |
| C_ID |
C00020637
, 
|
| InChIKey |
ZEACOKJOQLAYTD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H14O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,13-22H/t13-,14+,15-/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)OC(c1cc(O)c(O)c(O)c1)C(O)C2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Fabaceae | Alhagi maurorum | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima | Ref. |
| Plantae | Fabaceae | Hypocalyptus sophoroides | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca | Ref. |
| Plantae | Lythraceae | Punica granatum L. | Ref. |
| Plantae | Polygonaceae | Rumex hymenosepalus | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Nympaea spp. | Ref. |
|
|
zoom in
| Organism | Ephedra sinica |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|
