| Name |
Curcumenol |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
19431-84-6 |
| C_ID |
C00020351
, 
|
| InChIKey |
ISFMXVMWEWLJGJ-PQJGIFKXNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h7,11-12,16H,5-6,8H2,1-4H3/t11-,12-,14-,15+/m0/s1 |
| SMILES |
CC1=C[C@@]2(O)O[C@@]3(CC2=C(C)C)[C@@H](C)CC[C@@H]13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaecaulis | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
|
|
zoom in
| Organism | Tabernaemontana catharinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|