| Name |
Peucedanocoumarin II |
| Formula |
C21H22O7 |
| Mw |
386.13655306 |
| CAS RN |
130464-56-1 |
| C_ID |
C00019998
, 
|
| InChIKey |
LYUZYPKZQDYMEE-MUFZODEFNA-N |
| InChICode |
InChI=1S/C21H22O7/c1-6-11(2)20(24)27-18-16-14(28-21(4,5)19(18)25-12(3)22)9-7-13-8-10-15(23)26-17(13)16/h6-10,18-19H,1-5H3/b11-6-/t18-,19+/m1/s1 |
| SMILES |
C/C=C(/C)C(=O)O[C@@H]1c2c(ccc3ccc(=O)oc23)OC(C)(C)[C@H]1OC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Peucedanum govanianum var.bicolo | Ref. |
| Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
|
|
zoom in
| Organism | Peucedanum govanianum var.bicolo |
|---|
| Reference | Rao, et al., CCMM, 20, (1995), 740.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
