| Name |
6,7-Dihydroxy-3'-methoxy-4',5'-methylenedioxyisoflavone |
| Formula |
C17H12O7 |
| Mw |
328.05830274 |
| CAS RN |
557110-95-9 |
| C_ID |
C00019742
, 
|
| InChIKey |
CBYMNYOVHFOXTA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O7/c1-21-14-2-8(3-15-17(14)24-7-23-15)10-6-22-13-5-12(19)11(18)4-9(13)16(10)20/h2-6,18-19H,7H2,1H3 |
| SMILES |
COc1cc(-c2coc3cc(O)c(O)cc3c2=O)cc2c1OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Salicaceae | Salix cheilophila | Ref. |
| Plantae | Vitaceae | Ampelopsis grossedentata | Ref. |
|
|
zoom in
| Organism | Salix cheilophila |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
